C17H23ClN2O2 — CID 38335877
2-chloro-N-[2-(3-cyclopentylpropylamino)-2-oxoethyl]benzamide (PubChem CID 38335877) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-chloro-N-[2-(3-cyclopentylpropylamino)-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-(3-cyclopentylpropylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 38335877 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-chloro-N-[2-(3-cyclopentylpropylamino)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Cl)NCCCC1CCCC1 |
| InChI | InChI=1S/C17H23ClN2O2/c18-15-10-4-3-9-14(15)17(22)20-12-16(21)19-11-5-8-13-6-1-2-7-13/h3-4,9-10,13H,1-2,5-8,11-12H2,(H,19,21)(H,20,22) |
| InChIKey | ICNITHYZEVBUML-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|