C18H24O7 — CID 38348805
[(3aR,4S,5aR,6R,9aS,9bS)-6-hydroxy-5a-methyl-3-methylidene-2,9-dioxo-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-4-yl] (2R)-3-hydroxy-2-methylpropanoate (PubChem CID 38348805) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is [(3aR,4S,5aR,6R,9aS,9bS)-6-hydroxy-5a-methyl-3-methylidene-2,9-dioxo-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-4-yl] (2R)-3-hydroxy-2-methylpropanoate.
| Compound Name | [(3aR,4S,5aR,6R,9aS,9bS)-6-hydroxy-5a-methyl-3-methylidene-2,9-dioxo-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-4-yl] (2R)-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 38348805 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [(3aR,4S,5aR,6R,9aS,9bS)-6-hydroxy-5a-methyl-3-methylidene-2,9-dioxo-3a,4,5,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-4-yl] (2R)-3-hydroxy-2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(=O)[C@H](C)CO)C[C@@]1(C)[C@H](O)CCC(=O)[C@H]21 |
| InChI | InChI=1S/C18H24O7/c1-8(7-19)16(22)24-11-6-18(3)12(21)5-4-10(20)14(18)15-13(11)9(2)17(23)25-15/h8,11-15,19,21H,2,4-7H2,1,3H3/t8-,11+,12-,13-,14-,15+,18+/m1/s1 |
| InChIKey | QKSRJNOHZIOCSF-LKQATKCTSA-N |
| XLogP | 0.37 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|