C21H32O7 — CID 38349587
(1S,5S,8R,9R)-4,4,8-trimethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytricyclo[3.3.3.01,5]undec-2-ene-2-carbaldehyde (PubChem CID 38349587) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is (1S,5S,8R,9R)-4,4,8-trimethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytricyclo[3.3.3.01,5]undec-2-ene-2-carbaldehyde.
| Compound Name | (1S,5S,8R,9R)-4,4,8-trimethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytricyclo[3.3.3.01,5]undec-2-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 38349587 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (1S,5S,8R,9R)-4,4,8-trimethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytricyclo[3.3.3.01,5]undec-2-ene-2-carbaldehyde |
| SMILES | C[C@@H]1CC[C@@]23CC[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@]12C(C=O)=CC3(C)C |
| InChI | InChI=1S/C21H32O7/c1-11-4-6-20-7-5-14(21(11,20)12(9-22)8-19(20,2)3)28-18-17(26)16(25)15(24)13(10-23)27-18/h8-9,11,13-18,23-26H,4-7,10H2,1-3H3/t11-,13-,14-,15-,16+,17-,18+,20+,21+/m1/s1 |
| InChIKey | CPNJZUTZDMXCTF-XKWFVAMFSA-N |
| XLogP | 0.53 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|