C16H24O3 — CID 38357897
(3E,8R,11E,13E,16R)-8-hydroxy-16-methyl-1-oxacyclohexadeca-3,11,13-trien-2-one (PubChem CID 38357897) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (3E,8R,11E,13E,16R)-8-hydroxy-16-methyl-1-oxacyclohexadeca-3,11,13-trien-2-one.
| Compound Name | (3E,8R,11E,13E,16R)-8-hydroxy-16-methyl-1-oxacyclohexadeca-3,11,13-trien-2-one |
|---|---|
| PubChem CID | 38357897 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3E,8R,11E,13E,16R)-8-hydroxy-16-methyl-1-oxacyclohexadeca-3,11,13-trien-2-one |
| SMILES | C[C@@H]1C/C=C/C=C/CC[C@H](O)CCC/C=C/C(=O)O1 |
| InChI | InChI=1S/C16H24O3/c1-14-10-6-3-2-4-7-11-15(17)12-8-5-9-13-16(18)19-14/h2-4,6,9,13-15,17H,5,7-8,10-12H2,1H3/b4-2+,6-3+,13-9+/t14-,15+/m1/s1 |
| InChIKey | RULXJEXEFMKXHG-NBUTXBNQSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |