C22H28O11 — CID 38360727
[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R)-2-[(3S)-3-hydroxy-5-oxooxolan-3-yl]propoxy]oxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 38360727) has the molecular formula C22H28O11 and a molecular weight of 468.46 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R)-2-[(3S)-3-hydroxy-5-oxooxolan-3-yl]propoxy]oxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R)-2-[(3S)-3-hydroxy-5-oxooxolan-3-yl]propoxy]oxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 38360727 |
| Molecular Formula | C22H28O11 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R)-2-[(3S)-3-hydroxy-5-oxooxolan-3-yl]propoxy]oxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C[C@H](CO[C@@H]1O[C@H](COC(=O)/C=C/c2ccc(O)cc2)[C@@H](O)[C@H](O)[C@H]1O)[C@]1(O)COC(=O)C1 |
| InChI | InChI=1S/C22H28O11/c1-12(22(29)8-17(25)32-11-22)9-31-21-20(28)19(27)18(26)15(33-21)10-30-16(24)7-4-13-2-5-14(23)6-3-13/h2-7,12,15,18-21,23,26-29H,8-11H2,1H3/b7-4+/t12-,15-,18-,19+,20-,21-,22-/m1/s1 |
| InChIKey | NXPCNLFQDUFGJK-RPUDBBOQSA-N |
| XLogP | -0.91 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|