C20H24O10 — CID 74202884
[3,4,5-trihydroxy-6-(4-methyl-5-oxooxolan-3-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 74202884) has the molecular formula C20H24O10 and a molecular weight of 424.40 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(4-methyl-5-oxooxolan-3-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [3,4,5-trihydroxy-6-(4-methyl-5-oxooxolan-3-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 74202884 |
| Molecular Formula | C20H24O10 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [3,4,5-trihydroxy-6-(4-methyl-5-oxooxolan-3-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | CC1C(=O)OCC1OC1OC(COC(=O)C=Cc2ccc(O)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C20H24O10/c1-10-13(8-28-19(10)26)29-20-18(25)17(24)16(23)14(30-20)9-27-15(22)7-4-11-2-5-12(21)6-3-11/h2-7,10,13-14,16-18,20-21,23-25H,8-9H2,1H3 |
| InChIKey | AAQFUUDEHZBVHT-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|