C24H30O12 — CID 163083661
[6-[(4a,5,7-trihydroxy-7-methyl-1,5,6,7a-tetrahydrocyclopenta[c]pyran-1-yl)oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 163083661) has the molecular formula C24H30O12 and a molecular weight of 510.49 g/mol. Its IUPAC name is [6-[(4a,5,7-trihydroxy-7-methyl-1,5,6,7a-tetrahydrocyclopenta[c]pyran-1-yl)oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [6-[(4a,5,7-trihydroxy-7-methyl-1,5,6,7a-tetrahydrocyclopenta[c]pyran-1-yl)oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163083661 |
| Molecular Formula | C24H30O12 |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | [6-[(4a,5,7-trihydroxy-7-methyl-1,5,6,7a-tetrahydrocyclopenta[c]pyran-1-yl)oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | CC1(O)CC(O)C2(O)C=COC(OC3OC(COC(=O)C=Cc4ccc(O)cc4)C(O)C(O)C3O)C12 |
| InChI | InChI=1S/C24H30O12/c1-23(31)10-15(26)24(32)8-9-33-22(20(23)24)36-21-19(30)18(29)17(28)14(35-21)11-34-16(27)7-4-12-2-5-13(25)6-3-12/h2-9,14-15,17-22,25-26,28-32H,10-11H2,1H3 |
| InChIKey | DVGYMYBBSXLKHP-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|