C25H32O11 — CID 162944106
[4a,5-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl 3-phenylprop-2-enoate (PubChem CID 162944106) has the molecular formula C25H32O11 and a molecular weight of 508.52 g/mol. Its IUPAC name is [4a,5-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl 3-phenylprop-2-enoate.
| Compound Name | [4a,5-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162944106 |
| Molecular Formula | C25H32O11 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | [4a,5-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl 3-phenylprop-2-enoate |
| SMILES | CC1(COC(=O)C=Cc2ccccc2)CC(O)C2(O)C=COC(OC3OC(CO)C(O)C(O)C3O)C12 |
| InChI | InChI=1S/C25H32O11/c1-24(13-34-17(28)8-7-14-5-3-2-4-6-14)11-16(27)25(32)9-10-33-23(21(24)25)36-22-20(31)19(30)18(29)15(12-26)35-22/h2-10,15-16,18-23,26-27,29-32H,11-13H2,1H3 |
| InChIKey | ATYOTQNYJUPJBQ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|