C26H34O13 — CID 162863068
[(2R,3S,4S,5R,6S)-6-[[(1R,4aR,5S,7R,7aS)-4a,5,7-trihydroxy-7-methyl-1,5,6,7a-tetrahydrocyclopenta[c]pyran-1-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 162863068) has the molecular formula C26H34O13 and a molecular weight of 554.55 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[[(1R,4aR,5S,7R,7aS)-4a,5,7-trihydroxy-7-methyl-1,5,6,7a-tetrahydrocyclopenta[c]pyran-1-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[[(1R,4aR,5S,7R,7aS)-4a,5,7-trihydroxy-7-methyl-1,5,6,7a-tetrahydrocyclopenta[c]pyran-1-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162863068 |
| Molecular Formula | C26H34O13 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[(1R,4aR,5S,7R,7aS)-4a,5,7-trihydroxy-7-methyl-1,5,6,7a-tetrahydrocyclopenta[c]pyran-1-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OC[C@H]2O[C@@H](O[C@H]3OC=C[C@@]4(O)[C@@H]3[C@](C)(O)C[C@@H]4O)[C@H](O)[C@@H](O)[C@@H]2O)cc1OC |
| InChI | InChI=1S/C26H34O13/c1-25(32)11-17(27)26(33)8-9-36-24(22(25)26)39-23-21(31)20(30)19(29)16(38-23)12-37-18(28)7-5-13-4-6-14(34-2)15(10-13)35-3/h4-10,16-17,19-24,27,29-33H,11-12H2,1-3H3/t16-,17+,19-,20+,21-,22+,23+,24-,25-,26+/m1/s1 |
| InChIKey | RCKNZJXQBTVMJV-IHWYXQDQSA-N |
| XLogP | -1.18 |
| TPSA | 193.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|