C25H28O10 — CID 118729336
[(2R,3S,4S,5R,6S)-6-(4-acetylphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 118729336) has the molecular formula C25H28O10 and a molecular weight of 488.49 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-(4-acetylphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-(4-acetylphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 118729336 |
| Molecular Formula | C25H28O10 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-(4-acetylphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC[C@H]2O[C@@H](Oc3ccc(C(C)=O)cc3)[C@H](O)[C@@H](O)[C@@H]2O)cc1OC |
| InChI | InChI=1S/C25H28O10/c1-14(26)16-6-8-17(9-7-16)34-25-24(30)23(29)22(28)20(35-25)13-33-21(27)11-5-15-4-10-18(31-2)19(12-15)32-3/h4-12,20,22-25,28-30H,13H2,1-3H3/b11-5+/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | PEQJBVCPADTBEK-RWNYQXJYSA-N |
| XLogP | 1.35 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|