C31H32O13 — CID 171318781
[(2R,3S,4S,5R,6S)-6-[3,5-dihydroxy-4-[3-(4-hydroxyphenyl)propanoyl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 171318781) has the molecular formula C31H32O13 and a molecular weight of 612.58 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[3,5-dihydroxy-4-[3-(4-hydroxyphenyl)propanoyl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[3,5-dihydroxy-4-[3-(4-hydroxyphenyl)propanoyl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 171318781 |
| Molecular Formula | C31H32O13 |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[3,5-dihydroxy-4-[3-(4-hydroxyphenyl)propanoyl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OC[C@H]2O[C@@H](Oc3cc(O)c(C(=O)CCc4ccc(O)cc4)c(O)c3)[C@H](O)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C31H32O13/c1-41-24-12-17(5-9-20(24)33)6-11-26(37)42-15-25-28(38)29(39)30(40)31(44-25)43-19-13-22(35)27(23(36)14-19)21(34)10-4-16-2-7-18(32)8-3-16/h2-3,5-9,11-14,25,28-33,35-36,38-40H,4,10,15H2,1H3/t25-,28-,29+,30-,31-/m1/s1 |
| InChIKey | XPDRWWOVCUXRNF-KLBVUYHRSA-N |
| XLogP | 1.78 |
| TPSA | 212.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|