C19H29NO4S — CID 3838247
ethyl 1-(4-pentylphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 3838247) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is ethyl 1-(4-pentylphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-pentylphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 3838247 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl 1-(4-pentylphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCCCCc1ccc(S(=O)(=O)N2CCCC(C(=O)OCC)C2)cc1 |
| InChI | InChI=1S/C19H29NO4S/c1-3-5-6-8-16-10-12-18(13-11-16)25(22,23)20-14-7-9-17(15-20)19(21)24-4-2/h10-13,17H,3-9,14-15H2,1-2H3 |
| InChIKey | WDAATSVOZVKGIR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|