C7H10N2 — CID 3839092
N,6-dimethylpyridin-2-amine (PubChem CID 3839092) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is N,6-dimethylpyridin-2-amine.
| Compound Name | N,6-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 3839092 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | N,6-dimethylpyridin-2-amine |
| SMILES | CNc1cccc(C)n1 |
| InChI | InChI=1S/C7H10N2/c1-6-4-3-5-7(8-2)9-6/h3-5H,1-2H3,(H,8,9) |
| InChIKey | PFVYSURSVXECJA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |