C10H13NO2S3 — CID 3840043
2-[methyl(thiophen-2-ylmethyl)carbamothioyl]sulfanylpropanoic acid (PubChem CID 3840043) has the molecular formula C10H13NO2S3 and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylmethyl)carbamothioyl]sulfanylpropanoic acid.
| Compound Name | 2-[methyl(thiophen-2-ylmethyl)carbamothioyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 3840043 |
| Molecular Formula | C10H13NO2S3 |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 2-[methyl(thiophen-2-ylmethyl)carbamothioyl]sulfanylpropanoic acid |
| SMILES | CC(SC(=S)N(C)Cc1cccs1)C(=O)O |
| InChI | InChI=1S/C10H13NO2S3/c1-7(9(12)13)16-10(14)11(2)6-8-4-3-5-15-8/h3-5,7H,6H2,1-2H3,(H,12,13) |
| InChIKey | CREXPIAIZFTJSP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|