C23H17BrN4O3 — CID 3840140
2-[5-bromo-3-[(2-hydroxyphenyl)methylidenehydrazinylidene]-2-oxoindol-1-yl]-N-phenylacetamide (PubChem CID 3840140) has the molecular formula C23H17BrN4O3 and a molecular weight of 477.32 g/mol. Its IUPAC name is 2-[5-bromo-3-[(2-hydroxyphenyl)methylidenehydrazinylidene]-2-oxoindol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[5-bromo-3-[(2-hydroxyphenyl)methylidenehydrazinylidene]-2-oxoindol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3840140 |
| Molecular Formula | C23H17BrN4O3 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 2-[5-bromo-3-[(2-hydroxyphenyl)methylidenehydrazinylidene]-2-oxoindol-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)C(=NN=Cc2ccccc2O)c2cc(Br)ccc21)Nc1ccccc1 |
| InChI | InChI=1S/C23H17BrN4O3/c24-16-10-11-19-18(12-16)22(27-25-13-15-6-4-5-9-20(15)29)23(31)28(19)14-21(30)26-17-7-2-1-3-8-17/h1-13,29H,14H2,(H,26,30) |
| InChIKey | FJIYMAXJEZKVML-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|