C18H14BrN3O2 — CID 135702042
(3Z)-3-[(E)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1-prop-2-enylindol-2-one (PubChem CID 135702042) has the molecular formula C18H14BrN3O2 and a molecular weight of 384.23 g/mol. Its IUPAC name is (3Z)-3-[(E)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1-prop-2-enylindol-2-one.
| Compound Name | (3Z)-3-[(E)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 135702042 |
| Molecular Formula | C18H14BrN3O2 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (3Z)-3-[(E)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)/C(=N\N=C\c2cc(Br)ccc2O)c2ccccc21 |
| InChI | InChI=1S/C18H14BrN3O2/c1-2-9-22-15-6-4-3-5-14(15)17(18(22)24)21-20-11-12-10-13(19)7-8-16(12)23/h2-8,10-11,23H,1,9H2/b20-11+,21-17- |
| InChIKey | OGYIJLNPTCKKJV-QOGAHJOCSA-N |
| XLogP | 3.51 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|