C17H14N4O — CID 9216037
(3E)-1-prop-2-enyl-3-[(Z)-pyridin-2-ylmethylidenehydrazinylidene]indol-2-one (PubChem CID 9216037) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is (3E)-1-prop-2-enyl-3-[(Z)-pyridin-2-ylmethylidenehydrazinylidene]indol-2-one.
| Compound Name | (3E)-1-prop-2-enyl-3-[(Z)-pyridin-2-ylmethylidenehydrazinylidene]indol-2-one |
|---|---|
| PubChem CID | 9216037 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (3E)-1-prop-2-enyl-3-[(Z)-pyridin-2-ylmethylidenehydrazinylidene]indol-2-one |
| SMILES | C=CCN1C(=O)/C(=N/N=C\c2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C17H14N4O/c1-2-11-21-15-9-4-3-8-14(15)16(17(21)22)20-19-12-13-7-5-6-10-18-13/h2-10,12H,1,11H2/b19-12-,20-16+ |
| InChIKey | FWYOIORTEXHBRY-XTTOOUNRSA-N |
| XLogP | 2.44 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|