C18H13N4O4- — CID 9215978
2-nitro-4-[(Z)-[(Z)-(2-oxo-1-prop-2-enylindol-3-ylidene)hydrazinylidene]methyl]phenolate (PubChem CID 9215978) has the molecular formula C18H13N4O4- and a molecular weight of 349.33 g/mol. Its IUPAC name is 2-nitro-4-[(Z)-[(Z)-(2-oxo-1-prop-2-enylindol-3-ylidene)hydrazinylidene]methyl]phenolate.
| Compound Name | 2-nitro-4-[(Z)-[(Z)-(2-oxo-1-prop-2-enylindol-3-ylidene)hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 9215978 |
| Molecular Formula | C18H13N4O4- |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-nitro-4-[(Z)-[(Z)-(2-oxo-1-prop-2-enylindol-3-ylidene)hydrazinylidene]methyl]phenolate |
| SMILES | C=CCN1C(=O)/C(=N\N=C/c2ccc([O-])c([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C18H14N4O4/c1-2-9-21-14-6-4-3-5-13(14)17(18(21)24)20-19-11-12-7-8-16(23)15(10-12)22(25)26/h2-8,10-11,23H,1,9H2/p-1/b19-11-,20-17- |
| InChIKey | BCCLNKFLNJWPLR-HMXFOJJMSA-M |
| XLogP | 2.02 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|