C21H23N3O — CID 9216091
(3E)-3-(2-adamantylidenehydrazinylidene)-1-prop-2-enylindol-2-one (PubChem CID 9216091) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is (3E)-3-(2-adamantylidenehydrazinylidene)-1-prop-2-enylindol-2-one.
| Compound Name | (3E)-3-(2-adamantylidenehydrazinylidene)-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 9216091 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (3E)-3-(2-adamantylidenehydrazinylidene)-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)/C(=N/N=C2C3CC4CC(C3)CC2C4)c2ccccc21 |
| InChI | InChI=1S/C21H23N3O/c1-2-7-24-18-6-4-3-5-17(18)20(21(24)25)23-22-19-15-9-13-8-14(11-15)12-16(19)10-13/h2-6,13-16H,1,7-12H2/b22-19-,23-20+ |
| InChIKey | CLRKDNUTLRELIT-XOODDYIFSA-N |
| XLogP | 3.82 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|