C22H19N3O4S2 — CID 38403833
N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methyl-2-(5-methylfuran-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 38403833) has the molecular formula C22H19N3O4S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methyl-2-(5-methylfuran-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methyl-2-(5-methylfuran-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 38403833 |
| Molecular Formula | C22H19N3O4S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methyl-2-(5-methylfuran-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccc(-c2nc(C)c(C(=O)NCCN3C(=O)S/C(=C\c4ccccc4)C3=O)s2)o1 |
| InChI | InChI=1S/C22H19N3O4S2/c1-13-8-9-16(29-13)20-24-14(2)18(31-20)19(26)23-10-11-25-21(27)17(30-22(25)28)12-15-6-4-3-5-7-15/h3-9,12H,10-11H2,1-2H3,(H,23,26)/b17-12- |
| InChIKey | CXXDBQMQRNJHTO-ATVHPVEESA-N |
| XLogP | 4.49 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|