C24H21N3O4S2 — CID 4787065
5-methyl-N-[2-[5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 4787065) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 5-methyl-N-[2-[5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-[2-[5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 4787065 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 5-methyl-N-[2-[5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | CSc1ccc(C=C2SC(=O)N(CCNC(=O)c3nc(-c4ccccc4)oc3C)C2=O)cc1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-15-20(26-22(31-15)17-6-4-3-5-7-17)21(28)25-12-13-27-23(29)19(33-24(27)30)14-16-8-10-18(32-2)11-9-16/h3-11,14H,12-13H2,1-2H3,(H,25,28) |
| InChIKey | QKCDATYUBPYSKH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|