C20H18N6O3S2 — CID 2457514
7-methyl-N-[2-[(5Z)-5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 2457514) has the molecular formula C20H18N6O3S2 and a molecular weight of 454.54 g/mol. Its IUPAC name is 7-methyl-N-[2-[(5Z)-5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-methyl-N-[2-[(5Z)-5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 2457514 |
| Molecular Formula | C20H18N6O3S2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 7-methyl-N-[2-[(5Z)-5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CSc1ccc(/C=C2\SC(=O)N(CCNC(=O)c3nc4nccc(C)n4n3)C2=O)cc1 |
| InChI | InChI=1S/C20H18N6O3S2/c1-12-7-8-22-19-23-16(24-26(12)19)17(27)21-9-10-25-18(28)15(31-20(25)29)11-13-3-5-14(30-2)6-4-13/h3-8,11H,9-10H2,1-2H3,(H,21,27)/b15-11- |
| InChIKey | GIOWZEDMDQWFRZ-PTNGSMBKSA-N |
| XLogP | 2.62 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|