C14H15N5O2 — CID 38404382
3-amino-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]pyrazine-2-carboxamide (PubChem CID 38404382) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 3-amino-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 38404382 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-amino-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]pyrazine-2-carboxamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)c2nccnc2N)cc1 |
| InChI | InChI=1S/C14H15N5O2/c1-16-11(20)8-9-2-4-10(5-3-9)19-14(21)12-13(15)18-7-6-17-12/h2-7H,8H2,1H3,(H2,15,18)(H,16,20)(H,19,21) |
| InChIKey | DTHHJDXGVVKUIH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |