C18H15N5O2 — CID 154744382
3-N-[4-(pyridin-4-ylmethyl)phenyl]pyrazine-2,3-dicarboxamide (PubChem CID 154744382) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 3-N-[4-(pyridin-4-ylmethyl)phenyl]pyrazine-2,3-dicarboxamide.
| Compound Name | 3-N-[4-(pyridin-4-ylmethyl)phenyl]pyrazine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 154744382 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-N-[4-(pyridin-4-ylmethyl)phenyl]pyrazine-2,3-dicarboxamide |
| SMILES | NC(=O)c1nccnc1C(=O)Nc1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C18H15N5O2/c19-17(24)15-16(22-10-9-21-15)18(25)23-14-3-1-12(2-4-14)11-13-5-7-20-8-6-13/h1-10H,11H2,(H2,19,24)(H,23,25) |
| InChIKey | CYHYPJGYAIFDKR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |