C18H20ClN3O3S — CID 3841241
N-(3-chloro-4-morpholin-4-ylphenyl)-2-(1-thiophen-2-ylethylideneamino)oxyacetamide (PubChem CID 3841241) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-2-(1-thiophen-2-ylethylideneamino)oxyacetamide.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-2-(1-thiophen-2-ylethylideneamino)oxyacetamide |
|---|---|
| PubChem CID | 3841241 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-2-(1-thiophen-2-ylethylideneamino)oxyacetamide |
| SMILES | CC(=NOCC(=O)Nc1ccc(N2CCOCC2)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C18H20ClN3O3S/c1-13(17-3-2-10-26-17)21-25-12-18(23)20-14-4-5-16(15(19)11-14)22-6-8-24-9-7-22/h2-5,10-11H,6-9,12H2,1H3,(H,20,23) |
| InChIKey | BYERXLBPSPIAFV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|