C16H22N2S2 — CID 3842629
1-[(5-ethylthiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane (PubChem CID 3842629) has the molecular formula C16H22N2S2 and a molecular weight of 306.50 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(5-ethylthiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3842629 |
| Molecular Formula | C16H22N2S2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane |
| SMILES | CCc1ccc(C(c2cccs2)N2CCCNCC2)s1 |
| InChI | InChI=1S/C16H22N2S2/c1-2-13-6-7-15(20-13)16(14-5-3-12-19-14)18-10-4-8-17-9-11-18/h3,5-7,12,16-17H,2,4,8-11H2,1H3 |
| InChIKey | OTCMSJJDRQIKGG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |