C18H28N2S2 — CID 597835
N,N,N',N'-tetraethyl-1,2-dithiophen-2-ylethane-1,2-diamine (PubChem CID 597835) has the molecular formula C18H28N2S2 and a molecular weight of 336.57 g/mol. Its IUPAC name is N,N,N',N'-tetraethyl-1,2-dithiophen-2-ylethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetraethyl-1,2-dithiophen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 597835 |
| Molecular Formula | C18H28N2S2 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N,N,N',N'-tetraethyl-1,2-dithiophen-2-ylethane-1,2-diamine |
| SMILES | CCN(CC)C(c1cccs1)C(c1cccs1)N(CC)CC |
| InChI | InChI=1S/C18H28N2S2/c1-5-19(6-2)17(15-11-9-13-21-15)18(20(7-3)8-4)16-12-10-14-22-16/h9-14,17-18H,5-8H2,1-4H3 |
| InChIKey | IRPULSXPUYHSJI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |