C16H19NO — CID 3843226
N-(2,2-dimethylpropyl)-N-naphthalen-1-ylformamide (PubChem CID 3843226) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N-naphthalen-1-ylformamide.
| Compound Name | N-(2,2-dimethylpropyl)-N-naphthalen-1-ylformamide |
|---|---|
| PubChem CID | 3843226 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N-naphthalen-1-ylformamide |
| SMILES | CC(C)(C)CN(C=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H19NO/c1-16(2,3)11-17(12-18)15-10-6-8-13-7-4-5-9-14(13)15/h4-10,12H,11H2,1-3H3 |
| InChIKey | AHPMMRQUKVUESN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|