C17H20ClNO — CID 63678616
3-chloro-N-ethyl-2,2-dimethyl-N-naphthalen-1-ylpropanamide (PubChem CID 63678616) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is 3-chloro-N-ethyl-2,2-dimethyl-N-naphthalen-1-ylpropanamide.
| Compound Name | 3-chloro-N-ethyl-2,2-dimethyl-N-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 63678616 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-chloro-N-ethyl-2,2-dimethyl-N-naphthalen-1-ylpropanamide |
| SMILES | CCN(C(=O)C(C)(C)CCl)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H20ClNO/c1-4-19(16(20)17(2,3)12-18)15-11-7-9-13-8-5-6-10-14(13)15/h5-11H,4,12H2,1-3H3 |
| InChIKey | VEOSUMDYJNAXDF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|