C20H27NO2S — CID 3844087
2,3,4,5,6-pentamethyl-N-(2-phenylpropan-2-yl)benzenesulfonamide (PubChem CID 3844087) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-(2-phenylpropan-2-yl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-(2-phenylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3844087 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-(2-phenylpropan-2-yl)benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NC(C)(C)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C20H27NO2S/c1-13-14(2)16(4)19(17(5)15(13)3)24(22,23)21-20(6,7)18-11-9-8-10-12-18/h8-12,21H,1-7H3 |
| InChIKey | YZMZFAJEORQDCF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |