C27H36N4O2 — CID 38441199
(3S)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 38441199) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is (3S)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 38441199 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (3S)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)[C@H]3CC(=O)N(CCc4ccccc4)C3)CC2)c1 |
| InChI | InChI=1S/C27H36N4O2/c1-22-7-5-10-25(19-22)30-17-15-29(16-18-30)13-6-12-28-27(33)24-20-26(32)31(21-24)14-11-23-8-3-2-4-9-23/h2-5,7-10,19,24H,6,11-18,20-21H2,1H3,(H,28,33)/t24-/m0/s1 |
| InChIKey | DYFJBTJOEWPTLV-DEOSSOPVSA-N |
| XLogP | 2.71 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|