C26H34N4O2 — CID 40974935
(3R)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 40974935) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is (3R)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 40974935 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (3R)-N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)[C@@H]3CC(=O)N(CCc4ccccc4)C3)c(C)c2)CC1 |
| InChI | InChI=1S/C26H34N4O2/c1-3-28-13-15-29(16-14-28)23-9-10-24(20(2)17-23)27-26(32)22-18-25(31)30(19-22)12-11-21-7-5-4-6-8-21/h4-10,17,22H,3,11-16,18-19H2,1-2H3,(H,27,32)/t22-/m1/s1 |
| InChIKey | CMQRYJZZXWQQNN-JOCHJYFZSA-N |
| XLogP | 3.17 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|