C24H28N4O4S — CID 3844614
methyl 2-acetamido-6-[3-carbamoyl-2-methyl-5-(2-phenyl-1,3-thiazol-4-yl)pyrrol-1-yl]hexanoate (PubChem CID 3844614) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is methyl 2-acetamido-6-[3-carbamoyl-2-methyl-5-(2-phenyl-1,3-thiazol-4-yl)pyrrol-1-yl]hexanoate.
| Compound Name | methyl 2-acetamido-6-[3-carbamoyl-2-methyl-5-(2-phenyl-1,3-thiazol-4-yl)pyrrol-1-yl]hexanoate |
|---|---|
| PubChem CID | 3844614 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | methyl 2-acetamido-6-[3-carbamoyl-2-methyl-5-(2-phenyl-1,3-thiazol-4-yl)pyrrol-1-yl]hexanoate |
| SMILES | COC(=O)C(CCCCn1c(-c2csc(-c3ccccc3)n2)cc(C(N)=O)c1C)NC(C)=O |
| InChI | InChI=1S/C24H28N4O4S/c1-15-18(22(25)30)13-21(20-14-33-23(27-20)17-9-5-4-6-10-17)28(15)12-8-7-11-19(24(31)32-3)26-16(2)29/h4-6,9-10,13-14,19H,7-8,11-12H2,1-3H3,(H2,25,30)(H,26,29) |
| InChIKey | XJABHHAFLMMLMJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|