C25H27F3N4O5S — CID 3855758
methyl 2-acetamido-6-[3-carbamoyl-2-methyl-5-[2-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-4-yl]pyrrol-1-yl]hexanoate (PubChem CID 3855758) has the molecular formula C25H27F3N4O5S and a molecular weight of 552.58 g/mol. Its IUPAC name is methyl 2-acetamido-6-[3-carbamoyl-2-methyl-5-[2-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-4-yl]pyrrol-1-yl]hexanoate.
| Compound Name | methyl 2-acetamido-6-[3-carbamoyl-2-methyl-5-[2-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-4-yl]pyrrol-1-yl]hexanoate |
|---|---|
| PubChem CID | 3855758 |
| Molecular Formula | C25H27F3N4O5S |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | methyl 2-acetamido-6-[3-carbamoyl-2-methyl-5-[2-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-4-yl]pyrrol-1-yl]hexanoate |
| SMILES | COC(=O)C(CCCCn1c(-c2csc(-c3ccc(OC(F)(F)F)cc3)n2)cc(C(N)=O)c1C)NC(C)=O |
| InChI | InChI=1S/C25H27F3N4O5S/c1-14-18(22(29)34)12-21(32(14)11-5-4-6-19(24(35)36-3)30-15(2)33)20-13-38-23(31-20)16-7-9-17(10-8-16)37-25(26,27)28/h7-10,12-13,19H,4-6,11H2,1-3H3,(H2,29,34)(H,30,33) |
| InChIKey | OOMZPFIBTFSGTD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|