C25H34N4O3 — CID 3847441
4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-(3-hydroxypropyl)-2-methyl-5-pentylpyrrole-3-carboxamide (PubChem CID 3847441) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-(3-hydroxypropyl)-2-methyl-5-pentylpyrrole-3-carboxamide.
| Compound Name | 4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-(3-hydroxypropyl)-2-methyl-5-pentylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3847441 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-1-(3-hydroxypropyl)-2-methyl-5-pentylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2c(C)n(C)n(-c3ccccc3)c2=O)c(C(N)=O)c(C)n1CCCO |
| InChI | InChI=1S/C25H34N4O3/c1-5-6-8-14-20-23(21(24(26)31)18(3)28(20)15-11-16-30)22-17(2)27(4)29(25(22)32)19-12-9-7-10-13-19/h7,9-10,12-13,30H,5-6,8,11,14-16H2,1-4H3,(H2,26,31) |
| InChIKey | LJGWUYXSPRAZGW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|