C20H27ClN2O2 — CID 3857314
4-(2-chlorophenyl)-1-(3-hydroxypropyl)-2-methyl-5-pentylpyrrole-3-carboxamide (PubChem CID 3857314) has the molecular formula C20H27ClN2O2 and a molecular weight of 362.90 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-1-(3-hydroxypropyl)-2-methyl-5-pentylpyrrole-3-carboxamide.
| Compound Name | 4-(2-chlorophenyl)-1-(3-hydroxypropyl)-2-methyl-5-pentylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3857314 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 4-(2-chlorophenyl)-1-(3-hydroxypropyl)-2-methyl-5-pentylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2ccccc2Cl)c(C(N)=O)c(C)n1CCCO |
| InChI | InChI=1S/C20H27ClN2O2/c1-3-4-5-11-17-19(15-9-6-7-10-16(15)21)18(20(22)25)14(2)23(17)12-8-13-24/h6-7,9-10,24H,3-5,8,11-13H2,1-2H3,(H2,22,25) |
| InChIKey | VQTFTPFLPZKMCW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|