C20H26ClN2O2P — CID 59526418
4-(3-chloro-4-methylphenyl)-2-methyl-5-pentyl-1-(2-phosphorosoethyl)pyrrole-3-carboxamide (PubChem CID 59526418) has the molecular formula C20H26ClN2O2P and a molecular weight of 392.87 g/mol. Its IUPAC name is 4-(3-chloro-4-methylphenyl)-2-methyl-5-pentyl-1-(2-phosphorosoethyl)pyrrole-3-carboxamide.
| Compound Name | 4-(3-chloro-4-methylphenyl)-2-methyl-5-pentyl-1-(2-phosphorosoethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59526418 |
| Molecular Formula | C20H26ClN2O2P |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 4-(3-chloro-4-methylphenyl)-2-methyl-5-pentyl-1-(2-phosphorosoethyl)pyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2ccc(C)c(Cl)c2)c(C(N)=O)c(C)n1CCP=O |
| InChI | InChI=1S/C20H26ClN2O2P/c1-4-5-6-7-17-19(15-9-8-13(2)16(21)12-15)18(20(22)24)14(3)23(17)10-11-26-25/h8-9,12H,4-7,10-11H2,1-3H3,(H2,22,24) |
| InChIKey | VDMMQBYMVQQIGB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|