C35H38N4+2 — CID 3849206
1-methyl-3-[2-[1-[3-[4-[2-(1-methylindol-3-yl)ethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]ethyl]indole (PubChem CID 3849206) has the molecular formula C35H38N4+2 and a molecular weight of 514.72 g/mol. Its IUPAC name is 1-methyl-3-[2-[1-[3-[4-[2-(1-methylindol-3-yl)ethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]ethyl]indole.
| Compound Name | 1-methyl-3-[2-[1-[3-[4-[2-(1-methylindol-3-yl)ethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]ethyl]indole |
|---|---|
| PubChem CID | 3849206 |
| Molecular Formula | C35H38N4+2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 1-methyl-3-[2-[1-[3-[4-[2-(1-methylindol-3-yl)ethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]ethyl]indole |
| SMILES | Cn1cc(CCc2cc[n+](CCC[n+]3ccc(CCc4cn(C)c5ccccc45)cc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C35H38N4/c1-36-26-30(32-8-3-5-10-34(32)36)14-12-28-16-22-38(23-17-28)20-7-21-39-24-18-29(19-25-39)13-15-31-27-37(2)35-11-6-4-9-33(31)35/h3-6,8-11,16-19,22-27H,7,12-15,20-21H2,1-2H3/q+2 |
| InChIKey | OQYCPYFGZFWNMS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|