C19H16FN3O3 — CID 38536284
4-cyano-N-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide (PubChem CID 38536284) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is 4-cyano-N-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide.
| Compound Name | 4-cyano-N-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 38536284 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-cyano-N-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-2-methyl-5-pyrrol-1-ylfuran-3-carboxamide |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)NC[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FN3O3/c1-12-17(15(10-21)19(26-12)23-8-2-3-9-23)18(25)22-11-16(24)13-4-6-14(20)7-5-13/h2-9,16,24H,11H2,1H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | RUDWNKLWNZUMQV-MRXNPFEDSA-N |
| XLogP | 2.85 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|