C28H37N3O4S — CID 3855067
N-[2-(3,4-dimethoxyphenyl)ethyl]-8-(4-ethoxybenzoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3855067) has the molecular formula C28H37N3O4S and a molecular weight of 511.69 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-8-(4-ethoxybenzoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-8-(4-ethoxybenzoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3855067 |
| Molecular Formula | C28H37N3O4S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-8-(4-ethoxybenzoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | CCOc1ccc(C(=O)N2CCC3(CC2)CCN(C(=S)NCCc2ccc(OC)c(OC)c2)C3)cc1 |
| InChI | InChI=1S/C28H37N3O4S/c1-4-35-23-8-6-22(7-9-23)26(32)30-16-12-28(13-17-30)14-18-31(20-28)27(36)29-15-11-21-5-10-24(33-2)25(19-21)34-3/h5-10,19H,4,11-18,20H2,1-3H3,(H,29,36) |
| InChIKey | QIWQKYQNHCHYKT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|