C23H33N3O3S — CID 3672245
8-(4-ethoxybenzoyl)-N-(oxolan-2-ylmethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3672245) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 8-(4-ethoxybenzoyl)-N-(oxolan-2-ylmethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-(4-ethoxybenzoyl)-N-(oxolan-2-ylmethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3672245 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 8-(4-ethoxybenzoyl)-N-(oxolan-2-ylmethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | CCOc1ccc(C(=O)N2CCC3(CC2)CCN(C(=S)NCC2CCCO2)C3)cc1 |
| InChI | InChI=1S/C23H33N3O3S/c1-2-28-19-7-5-18(6-8-19)21(27)25-12-9-23(10-13-25)11-14-26(17-23)22(30)24-16-20-4-3-15-29-20/h5-8,20H,2-4,9-17H2,1H3,(H,24,30) |
| InChIKey | WOXKBMOPMMTOHS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|