C25H35N3O2S — CID 3860223
8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-(oxolan-2-ylmethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3860223) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is 8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-(oxolan-2-ylmethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-(oxolan-2-ylmethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3860223 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-N-(oxolan-2-ylmethyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | O=C(CC1Cc2ccccc2C1)N1CCC2(CC1)CCN(C(=S)NCC1CCCO1)C2 |
| InChI | InChI=1S/C25H35N3O2S/c29-23(16-19-14-20-4-1-2-5-21(20)15-19)27-10-7-25(8-11-27)9-12-28(18-25)24(31)26-17-22-6-3-13-30-22/h1-2,4-5,19,22H,3,6-18H2,(H,26,31) |
| InChIKey | SNZBCDHPBDYSGT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|