C21H29N3O2S2 — CID 3752492
N-(oxolan-2-ylmethyl)-8-(3-thiophen-3-ylprop-2-enoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3752492) has the molecular formula C21H29N3O2S2 and a molecular weight of 419.62 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-8-(3-thiophen-3-ylprop-2-enoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | N-(oxolan-2-ylmethyl)-8-(3-thiophen-3-ylprop-2-enoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3752492 |
| Molecular Formula | C21H29N3O2S2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-8-(3-thiophen-3-ylprop-2-enoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | O=C(C=Cc1ccsc1)N1CCC2(CC1)CCN(C(=S)NCC1CCCO1)C2 |
| InChI | InChI=1S/C21H29N3O2S2/c25-19(4-3-17-5-13-28-15-17)23-9-6-21(7-10-23)8-11-24(16-21)20(27)22-14-18-2-1-12-26-18/h3-5,13,15,18H,1-2,6-12,14,16H2,(H,22,27) |
| InChIKey | ACAWCKXGPXQAAF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|