C28H27N3O3S — CID 3447081
1-[2-(3-benzoylpyridine-2-carbonyl)-2,8-diazaspiro[4.5]decan-8-yl]-3-thiophen-3-ylprop-2-en-1-one (PubChem CID 3447081) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is 1-[2-(3-benzoylpyridine-2-carbonyl)-2,8-diazaspiro[4.5]decan-8-yl]-3-thiophen-3-ylprop-2-en-1-one.
| Compound Name | 1-[2-(3-benzoylpyridine-2-carbonyl)-2,8-diazaspiro[4.5]decan-8-yl]-3-thiophen-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 3447081 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 1-[2-(3-benzoylpyridine-2-carbonyl)-2,8-diazaspiro[4.5]decan-8-yl]-3-thiophen-3-ylprop-2-en-1-one |
| SMILES | O=C(c1ccccc1)c1cccnc1C(=O)N1CCC2(CCN(C(=O)C=Cc3ccsc3)CC2)C1 |
| InChI | InChI=1S/C28H27N3O3S/c32-24(9-8-21-10-18-35-19-21)30-15-11-28(12-16-30)13-17-31(20-28)27(34)25-23(7-4-14-29-25)26(33)22-5-2-1-3-6-22/h1-10,14,18-19H,11-13,15-17,20H2 |
| InChIKey | BLWBGXOQHAQBAK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|