C26H29N3O3S — CID 3835086
1-phenyl-4-[8-(3-thiophen-3-ylprop-2-enoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]pyrrolidin-2-one (PubChem CID 3835086) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 1-phenyl-4-[8-(3-thiophen-3-ylprop-2-enoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-phenyl-4-[8-(3-thiophen-3-ylprop-2-enoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 3835086 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1-phenyl-4-[8-(3-thiophen-3-ylprop-2-enoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]pyrrolidin-2-one |
| SMILES | O=C(C=Cc1ccsc1)N1CCC2(CC1)CCN(C(=O)C1CC(=O)N(c3ccccc3)C1)C2 |
| InChI | InChI=1S/C26H29N3O3S/c30-23(7-6-20-8-15-33-18-20)27-12-9-26(10-13-27)11-14-28(19-26)25(32)21-16-24(31)29(17-21)22-4-2-1-3-5-22/h1-8,15,18,21H,9-14,16-17,19H2 |
| InChIKey | GJXZTBLWNWYYDI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|