C25H28N2O4S — CID 74224421
[(1R)-2-oxo-1-phenyl-2-[8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decan-2-yl]ethyl] acetate (PubChem CID 74224421) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is [(1R)-2-oxo-1-phenyl-2-[8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decan-2-yl]ethyl] acetate.
| Compound Name | [(1R)-2-oxo-1-phenyl-2-[8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 74224421 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(1R)-2-oxo-1-phenyl-2-[8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decan-2-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C(=O)N1CCC2(CCN(C(=O)/C=C/c3ccsc3)CC2)C1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O4S/c1-19(28)31-23(21-5-3-2-4-6-21)24(30)27-15-12-25(18-27)10-13-26(14-11-25)22(29)8-7-20-9-16-32-17-20/h2-9,16-17,23H,10-15,18H2,1H3/b8-7+/t23-/m1/s1 |
| InChIKey | MKDPDPTWNDWKTO-NDEDVSTASA-N |
| XLogP | 3.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|