C25H36N4O3S — CID 74225181
(4S,5R)-4-methyl-5-[6-oxo-6-[8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decan-2-yl]hexyl]imidazolidin-2-one (PubChem CID 74225181) has the molecular formula C25H36N4O3S and a molecular weight of 472.66 g/mol. Its IUPAC name is (4S,5R)-4-methyl-5-[6-oxo-6-[8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decan-2-yl]hexyl]imidazolidin-2-one.
| Compound Name | (4S,5R)-4-methyl-5-[6-oxo-6-[8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decan-2-yl]hexyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 74225181 |
| Molecular Formula | C25H36N4O3S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | (4S,5R)-4-methyl-5-[6-oxo-6-[8-[(E)-3-thiophen-3-ylprop-2-enoyl]-2,8-diazaspiro[4.5]decan-2-yl]hexyl]imidazolidin-2-one |
| SMILES | C[C@@H]1NC(=O)N[C@@H]1CCCCCC(=O)N1CCC2(CCN(C(=O)/C=C/c3ccsc3)CC2)C1 |
| InChI | InChI=1S/C25H36N4O3S/c1-19-21(27-24(32)26-19)5-3-2-4-6-22(30)29-15-12-25(18-29)10-13-28(14-11-25)23(31)8-7-20-9-16-33-17-20/h7-9,16-17,19,21H,2-6,10-15,18H2,1H3,(H2,26,27,32)/b8-7+/t19-,21+/m0/s1 |
| InChIKey | KAKANNURQQWNFL-PDPIDTGVSA-N |
| XLogP | 3.62 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|