C27H40N4O4 — CID 3855246
4-[6-[8-[2-(3-methoxyphenyl)acetyl]-2,8-diazaspiro[4.5]decan-2-yl]-6-oxohexyl]-5-methylimidazolidin-2-one (PubChem CID 3855246) has the molecular formula C27H40N4O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is 4-[6-[8-[2-(3-methoxyphenyl)acetyl]-2,8-diazaspiro[4.5]decan-2-yl]-6-oxohexyl]-5-methylimidazolidin-2-one.
| Compound Name | 4-[6-[8-[2-(3-methoxyphenyl)acetyl]-2,8-diazaspiro[4.5]decan-2-yl]-6-oxohexyl]-5-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 3855246 |
| Molecular Formula | C27H40N4O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 4-[6-[8-[2-(3-methoxyphenyl)acetyl]-2,8-diazaspiro[4.5]decan-2-yl]-6-oxohexyl]-5-methylimidazolidin-2-one |
| SMILES | COc1cccc(CC(=O)N2CCC3(CC2)CCN(C(=O)CCCCCC2NC(=O)NC2C)C3)c1 |
| InChI | InChI=1S/C27H40N4O4/c1-20-23(29-26(34)28-20)9-4-3-5-10-24(32)31-16-13-27(19-31)11-14-30(15-12-27)25(33)18-21-7-6-8-22(17-21)35-2/h6-8,17,20,23H,3-5,9-16,18-19H2,1-2H3,(H2,28,29,34) |
| InChIKey | WADXQBGITHUOSQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|