C21H30N4O4S — CID 3379503
N-[2-oxo-2-[2-(oxolan-2-ylmethylcarbamothioyl)-2,8-diazaspiro[4.5]decan-8-yl]ethyl]furan-2-carboxamide (PubChem CID 3379503) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is N-[2-oxo-2-[2-(oxolan-2-ylmethylcarbamothioyl)-2,8-diazaspiro[4.5]decan-8-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-oxo-2-[2-(oxolan-2-ylmethylcarbamothioyl)-2,8-diazaspiro[4.5]decan-8-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3379503 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[2-oxo-2-[2-(oxolan-2-ylmethylcarbamothioyl)-2,8-diazaspiro[4.5]decan-8-yl]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCC2(CC1)CCN(C(=S)NCC1CCCO1)C2)c1ccco1 |
| InChI | InChI=1S/C21H30N4O4S/c26-18(14-22-19(27)17-4-2-12-29-17)24-8-5-21(6-9-24)7-10-25(15-21)20(30)23-13-16-3-1-11-28-16/h2,4,12,16H,1,3,5-11,13-15H2,(H,22,27)(H,23,30) |
| InChIKey | HLMUTWXTTAEGSF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|