C26H37N3OS — CID 3722675
N-cyclohexyl-8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3722675) has the molecular formula C26H37N3OS and a molecular weight of 439.67 g/mol. Its IUPAC name is N-cyclohexyl-8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | N-cyclohexyl-8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3722675 |
| Molecular Formula | C26H37N3OS |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | N-cyclohexyl-8-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | O=C(CC1Cc2ccccc2C1)N1CCC2(CC1)CCN(C(=S)NC1CCCCC1)C2 |
| InChI | InChI=1S/C26H37N3OS/c30-24(18-20-16-21-6-4-5-7-22(21)17-20)28-13-10-26(11-14-28)12-15-29(19-26)25(31)27-23-8-2-1-3-9-23/h4-7,20,23H,1-3,8-19H2,(H,27,31) |
| InChIKey | NUZTZIGDOBDRLS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|